C17H28N2 — CID 115568741
N-(2,3-dihydro-1H-indol-2-ylmethyl)octan-1-amine (PubChem CID 115568741) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-2-ylmethyl)octan-1-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-2-ylmethyl)octan-1-amine |
|---|---|
| PubChem CID | 115568741 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-2-ylmethyl)octan-1-amine |
| SMILES | CCCCCCCCNCC1Cc2ccccc2N1 |
| InChI | InChI=1S/C17H28N2/c1-2-3-4-5-6-9-12-18-14-16-13-15-10-7-8-11-17(15)19-16/h7-8,10-11,16,18-19H,2-6,9,12-14H2,1H3 |
| InChIKey | FLRMGJZOXYOHIV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|