C19H24N2 — CID 125489057
3-phenyl-N-[[(2R)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]propan-1-amine (PubChem CID 125489057) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-phenyl-N-[[(2R)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]propan-1-amine.
| Compound Name | 3-phenyl-N-[[(2R)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 125489057 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3-phenyl-N-[[(2R)-1,2,3,4-tetrahydroquinolin-2-yl]methyl]propan-1-amine |
| SMILES | c1ccc(CCCNC[C@H]2CCc3ccccc3N2)cc1 |
| InChI | InChI=1S/C19H24N2/c1-2-7-16(8-3-1)9-6-14-20-15-18-13-12-17-10-4-5-11-19(17)21-18/h1-5,7-8,10-11,18,20-21H,6,9,12-15H2/t18-/m1/s1 |
| InChIKey | ZDNFITHXQXURBP-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|