C15H15N — CID 71608217
(2R)-2-benzyl-2,3-dihydro-1H-indole (PubChem CID 71608217) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol. Its IUPAC name is (2R)-2-benzyl-2,3-dihydro-1H-indole.
| Compound Name | (2R)-2-benzyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 71608217 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (2R)-2-benzyl-2,3-dihydro-1H-indole |
| SMILES | c1ccc(C[C@@H]2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C15H15N/c1-2-6-12(7-3-1)10-14-11-13-8-4-5-9-15(13)16-14/h1-9,14,16H,10-11H2/t14-/m1/s1 |
| InChIKey | VVAJLLNURZDAGM-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |