C10H16Cl2N2 — CID 165454907
2-(2,3-dihydro-1H-indol-2-yl)ethanamine;dihydrochloride (PubChem CID 165454907) has the molecular formula C10H16Cl2N2 and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-2-yl)ethanamine;dihydrochloride.
| Compound Name | 2-(2,3-dihydro-1H-indol-2-yl)ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 165454907 |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-2-yl)ethanamine;dihydrochloride |
| SMILES | Cl.Cl.NCCC1Cc2ccccc2N1 |
| InChI | InChI=1S/C10H14N2.2ClH/c11-6-5-9-7-8-3-1-2-4-10(8)12-9;;/h1-4,9,12H,5-7,11H2;2*1H |
| InChIKey | BTYSXEGPSJFWJS-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |