C15H14FNO — CID 115104070
2-[(2-fluorophenoxy)methyl]-2,3-dihydro-1H-indole (PubChem CID 115104070) has the molecular formula C15H14FNO and a molecular weight of 243.28 g/mol. Its IUPAC name is 2-[(2-fluorophenoxy)methyl]-2,3-dihydro-1H-indole.
| Compound Name | 2-[(2-fluorophenoxy)methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 115104070 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 2-[(2-fluorophenoxy)methyl]-2,3-dihydro-1H-indole |
| SMILES | Fc1ccccc1OCC1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H14FNO/c16-13-6-2-4-8-15(13)18-10-12-9-11-5-1-3-7-14(11)17-12/h1-8,12,17H,9-10H2 |
| InChIKey | PZWOETXXIIUCSV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |