C12H16N2 — CID 143815191
2-(2,3-dihydro-1H-indol-2-yl)-N-ethenylethanamine (PubChem CID 143815191) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-indol-2-yl)-N-ethenylethanamine.
| Compound Name | 2-(2,3-dihydro-1H-indol-2-yl)-N-ethenylethanamine |
|---|---|
| PubChem CID | 143815191 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-(2,3-dihydro-1H-indol-2-yl)-N-ethenylethanamine |
| SMILES | C=CNCCC1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H16N2/c1-2-13-8-7-11-9-10-5-3-4-6-12(10)14-11/h2-6,11,13-14H,1,7-9H2 |
| InChIKey | AZAOLOOFBGJUOM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|