C9H12N2 — CID 82667971
[(2S)-2,3-dihydro-1H-indol-2-yl]methanamine (PubChem CID 82667971) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is [(2S)-2,3-dihydro-1H-indol-2-yl]methanamine.
| Compound Name | [(2S)-2,3-dihydro-1H-indol-2-yl]methanamine |
|---|---|
| PubChem CID | 82667971 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | [(2S)-2,3-dihydro-1H-indol-2-yl]methanamine |
| SMILES | NC[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C9H12N2/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,8,11H,5-6,10H2/t8-/m0/s1 |
| InChIKey | QOPBJIHGSQNGTB-QMMMGPOBSA-N |
| XLogP | 0.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |