C22H21N — CID 15312192
(2R,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 15312192) has the molecular formula C22H21N and a molecular weight of 299.42 g/mol. Its IUPAC name is (2R,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 15312192 |
| Molecular Formula | C22H21N |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (2R,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc(C[C@H]2Nc3ccccc3C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N/c1-3-9-17(10-4-1)15-22-20(18-11-5-2-6-12-18)16-19-13-7-8-14-21(19)23-22/h1-14,20,22-23H,15-16H2/t20-,22-/m1/s1 |
| InChIKey | ZUGWOUCWLZMYPE-IFMALSPDSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |