C15H18N2O — CID 80567501
N-(2,3-dihydro-1H-indol-2-ylmethyl)-2-(furan-2-yl)ethanamine (PubChem CID 80567501) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-2-ylmethyl)-2-(furan-2-yl)ethanamine.
| Compound Name | N-(2,3-dihydro-1H-indol-2-ylmethyl)-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 80567501 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-2-ylmethyl)-2-(furan-2-yl)ethanamine |
| SMILES | c1coc(CCNCC2Cc3ccccc3N2)c1 |
| InChI | InChI=1S/C15H18N2O/c1-2-6-15-12(4-1)10-13(17-15)11-16-8-7-14-5-3-9-18-14/h1-6,9,13,16-17H,7-8,10-11H2 |
| InChIKey | CINWRGWSAPYGLI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|