C11H17NO3 — CID 81102042
N-(1,3-dioxan-4-ylmethyl)-2-(furan-2-yl)ethanamine (PubChem CID 81102042) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2-(furan-2-yl)ethanamine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 81102042 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2-(furan-2-yl)ethanamine |
| SMILES | c1coc(CCNCC2CCOCO2)c1 |
| InChI | InChI=1S/C11H17NO3/c1-2-10(14-6-1)3-5-12-8-11-4-7-13-9-15-11/h1-2,6,11-12H,3-5,7-9H2 |
| InChIKey | VWJSCZPGKNTSAL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|