C11H22N2O3 — CID 81101551
N-(1,3-dioxan-4-ylmethyl)-2-morpholin-4-ylethanamine (PubChem CID 81101551) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-2-morpholin-4-ylethanamine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-2-morpholin-4-ylethanamine |
|---|---|
| PubChem CID | 81101551 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-2-morpholin-4-ylethanamine |
| SMILES | C(CN1CCOCC1)NCC1CCOCO1 |
| InChI | InChI=1S/C11H22N2O3/c1-6-15-10-16-11(1)9-12-2-3-13-4-7-14-8-5-13/h11-12H,1-10H2 |
| InChIKey | GMBZWHGWJFWPFU-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|