C12H24N2O2 — CID 81100973
N-(1,3-dioxan-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine (PubChem CID 81100973) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine |
|---|---|
| PubChem CID | 81100973 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-3-pyrrolidin-1-ylpropan-1-amine |
| SMILES | C1CCN(CCCNCC2CCOCO2)C1 |
| InChI | InChI=1S/C12H24N2O2/c1-2-7-14(6-1)8-3-5-13-10-12-4-9-15-11-16-12/h12-13H,1-11H2 |
| InChIKey | TZXJBJJZQOEIAK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|