C10H19NO3 — CID 81102550
N-(1,3-dioxan-4-ylmethyl)-1-(oxolan-3-yl)methanamine (PubChem CID 81102550) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(1,3-dioxan-4-ylmethyl)-1-(oxolan-3-yl)methanamine.
| Compound Name | N-(1,3-dioxan-4-ylmethyl)-1-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 81102550 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-(1,3-dioxan-4-ylmethyl)-1-(oxolan-3-yl)methanamine |
| SMILES | C1CC(CNCC2CCOC2)OCO1 |
| InChI | InChI=1S/C10H19NO3/c1-3-12-7-9(1)5-11-6-10-2-4-13-8-14-10/h9-11H,1-8H2 |
| InChIKey | MYJYRBCMRQWQIO-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |