About 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine
1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine (PubChem CID 81101660) has the molecular formula C9H17NO2
and a molecular weight of 171.24 g/mol. Its IUPAC name is 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine.
Analyze 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine?
The IUPAC name of 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine (CID 81101660) is 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine.
What is the SMILES notation for 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine?
The canonical SMILES for 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine is C1CC(CNCC2CC2)OCO1.
What is the InChIKey of 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine?
The InChIKey is YGMYAXMHYZSOND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2/c1-2-8(1)5-10-6-9-3-4-11-7-12-9/h8-10H,1-7H2.
What are the key properties of 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine?
1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine has a molecular weight of 171.24 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N-(1,3-dioxan-4-ylmethyl)methanamine is sourced from PubChem (CID 81101660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).