C16H25N — CID 54922061
N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)heptan-1-amine (PubChem CID 54922061) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)heptan-1-amine.
| Compound Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)heptan-1-amine |
|---|---|
| PubChem CID | 54922061 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | N-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)heptan-1-amine |
| SMILES | CCCCCCCNCC1Cc2ccccc21 |
| InChI | InChI=1S/C16H25N/c1-2-3-4-5-8-11-17-13-15-12-14-9-6-7-10-16(14)15/h6-7,9-10,15,17H,2-5,8,11-13H2,1H3 |
| InChIKey | WYNLNJFJIGVGNO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|