C12H17N — CID 15312191
(2R,3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 15312191) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2R,3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 15312191 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (2R,3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | CC[C@H]1Nc2ccccc2C[C@H]1C |
| InChI | InChI=1S/C12H17N/c1-3-11-9(2)8-10-6-4-5-7-12(10)13-11/h4-7,9,11,13H,3,8H2,1-2H3/t9-,11-/m1/s1 |
| InChIKey | ZBOCLUCAMWTOOV-MWLCHTKSSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |