C13H18 — CID 163672179
(3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 163672179) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is (3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 163672179 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | (3R)-2-ethyl-3-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CCC1Cc2ccccc2C[C@H]1C |
| InChI | InChI=1S/C13H18/c1-3-11-9-13-7-5-4-6-12(13)8-10(11)2/h4-7,10-11H,3,8-9H2,1-2H3/t10-,11?/m1/s1 |
| InChIKey | JDMZFQHMHRNMGV-NFJWQWPMSA-N |
| XLogP | 3.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |