C12H17N — CID 89333129
(7S)-6,7-diethyl-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 89333129) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (7S)-6,7-diethyl-6,7-dihydro-5H-cyclopenta[b]pyridine.
| Compound Name | (7S)-6,7-diethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
|---|---|
| PubChem CID | 89333129 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (7S)-6,7-diethyl-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | CCC1Cc2cccnc2[C@H]1CC |
| InChI | InChI=1S/C12H17N/c1-3-9-8-10-6-5-7-13-12(10)11(9)4-2/h5-7,9,11H,3-4,8H2,1-2H3/t9?,11-/m0/s1 |
| InChIKey | VHGQSDBXJVLZEU-UMJHXOGRSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |