C10H13NO — CID 90142368
2-ethyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine (PubChem CID 90142368) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 2-ethyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine.
| Compound Name | 2-ethyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
|---|---|
| PubChem CID | 90142368 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 2-ethyl-3,4-dihydro-2H-pyrano[2,3-b]pyridine |
| SMILES | CCC1CCc2cccnc2O1 |
| InChI | InChI=1S/C10H13NO/c1-2-9-6-5-8-4-3-7-11-10(8)12-9/h3-4,7,9H,2,5-6H2,1H3 |
| InChIKey | OPAZUEDPOJRAMY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |