About 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane
7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane (PubChem CID 144513567) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane.
Analyze 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane?
The IUPAC name of 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane (CID 144513567) is 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane.
What is the SMILES notation for 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane?
The canonical SMILES for 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane is CC1CCc2cccnc21.CCC.
What is the InChIKey of 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane?
The InChIKey is RFOXTMIDRORHPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N.C3H8/c1-7-4-5-8-3-2-6-10-9(7)8;1-3-2/h2-3,6-7H,4-5H2,1H3;3H2,1-2H3.
What are the key properties of 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane?
7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane has a molecular weight of 177.29 g/mol, XLogP of 3.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine;propane is sourced from PubChem (CID 144513567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).