About 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine
7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 146551698) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine.
Analyze 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 146551698) is 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine is CC(C)OC1CCc2cccnc21.
What is the InChIKey of 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is MNBXNWHXUAVZCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-8(2)13-10-6-5-9-4-3-7-12-11(9)10/h3-4,7-8,10H,5-6H2,1-2H3.
What are the key properties of 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine?
7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 177.25 g/mol, XLogP of 2.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yloxy-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 146551698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).