C12H17N — CID 58752937
(8R)-8-propan-2-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 58752937) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is (8R)-8-propan-2-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | (8R)-8-propan-2-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 58752937 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | (8R)-8-propan-2-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | CC(C)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C12H17N/c1-9(2)11-7-3-5-10-6-4-8-13-12(10)11/h4,6,8-9,11H,3,5,7H2,1-2H3/t11-/m1/s1 |
| InChIKey | QSIQJZBBKBXYFR-LLVKDONJSA-N |
| XLogP | 3.16 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |