C14H21N — CID 67125718
8-pentan-2-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 67125718) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 8-pentan-2-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 8-pentan-2-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 67125718 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 8-pentan-2-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | CCCC(C)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H21N/c1-3-6-11(2)13-9-4-7-12-8-5-10-15-14(12)13/h5,8,10-11,13H,3-4,6-7,9H2,1-2H3 |
| InChIKey | PZZKRPMZEDIAIC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |