C13H20N2 — CID 79748417
1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-amine (PubChem CID 79748417) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-amine.
| Compound Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-amine |
|---|---|
| PubChem CID | 79748417 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-amine |
| SMILES | CCCC(N)C1CCCc2cccnc21 |
| InChI | InChI=1S/C13H20N2/c1-2-5-12(14)11-8-3-6-10-7-4-9-15-13(10)11/h4,7,9,11-12H,2-3,5-6,8,14H2,1H3 |
| InChIKey | NHRACUDOCWLOCT-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |