C13H17NO2 — CID 81009137
3-(5,6,7,8-tetrahydroquinolin-8-yl)butanoic acid (PubChem CID 81009137) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-(5,6,7,8-tetrahydroquinolin-8-yl)butanoic acid.
| Compound Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)butanoic acid |
|---|---|
| PubChem CID | 81009137 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-(5,6,7,8-tetrahydroquinolin-8-yl)butanoic acid |
| SMILES | CC(CC(=O)O)C1CCCc2cccnc21 |
| InChI | InChI=1S/C13H17NO2/c1-9(8-12(15)16)11-6-2-4-10-5-3-7-14-13(10)11/h3,5,7,9,11H,2,4,6,8H2,1H3,(H,15,16) |
| InChIKey | BWRHCCDFRFGATA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |