C16H17NO — CID 79739489
phenyl(5,6,7,8-tetrahydroquinolin-8-yl)methanol (PubChem CID 79739489) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is phenyl(5,6,7,8-tetrahydroquinolin-8-yl)methanol.
| Compound Name | phenyl(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
|---|---|
| PubChem CID | 79739489 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | phenyl(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
| SMILES | OC(c1ccccc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H17NO/c18-16(13-6-2-1-3-7-13)14-10-4-8-12-9-5-11-17-15(12)14/h1-3,5-7,9,11,14,16,18H,4,8,10H2 |
| InChIKey | HVWPBVDXBYSGSX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |