C18H21NO2 — CID 79721633
(3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol (PubChem CID 79721633) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol.
| Compound Name | (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
|---|---|
| PubChem CID | 79721633 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
| SMILES | CCOc1cccc(C(O)C2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C18H21NO2/c1-2-21-15-9-3-7-14(12-15)18(20)16-10-4-6-13-8-5-11-19-17(13)16/h3,5,7-9,11-12,16,18,20H,2,4,6,10H2,1H3 |
| InChIKey | SJZJEBHAPIZDDW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |