C16H18N2O — CID 106695855
(3-aminophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol (PubChem CID 106695855) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (3-aminophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol.
| Compound Name | (3-aminophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
|---|---|
| PubChem CID | 106695855 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (3-aminophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
| SMILES | Nc1cccc(C(O)C2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C16H18N2O/c17-13-7-1-5-12(10-13)16(19)14-8-2-4-11-6-3-9-18-15(11)14/h1,3,5-7,9-10,14,16,19H,2,4,8,17H2 |
| InChIKey | IIXDCWSQSHHKEH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|