C15H17N3 — CID 79748903
pyridin-3-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine (PubChem CID 79748903) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is pyridin-3-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine.
| Compound Name | pyridin-3-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
|---|---|
| PubChem CID | 79748903 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | pyridin-3-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
| SMILES | NC(c1cccnc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C15H17N3/c16-14(12-6-2-8-17-10-12)13-7-1-4-11-5-3-9-18-15(11)13/h2-3,5-6,8-10,13-14H,1,4,7,16H2 |
| InChIKey | QFTNSJSKSPYDEE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |