C16H17BrN2 — CID 79745613
(4-bromophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine (PubChem CID 79745613) has the molecular formula C16H17BrN2 and a molecular weight of 317.23 g/mol. Its IUPAC name is (4-bromophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine.
| Compound Name | (4-bromophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
|---|---|
| PubChem CID | 79745613 |
| Molecular Formula | C16H17BrN2 |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | (4-bromophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
| SMILES | NC(c1ccc(Br)cc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H17BrN2/c17-13-8-6-11(7-9-13)15(18)14-5-1-3-12-4-2-10-19-16(12)14/h2,4,6-10,14-15H,1,3,5,18H2 |
| InChIKey | FFLHQFQXBIQEET-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |