C18H22N2O — CID 79731976
(3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine (PubChem CID 79731976) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine.
| Compound Name | (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
|---|---|
| PubChem CID | 79731976 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (3-ethoxyphenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
| SMILES | CCOc1cccc(C(N)C2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C18H22N2O/c1-2-21-15-9-3-7-14(12-15)17(19)16-10-4-6-13-8-5-11-20-18(13)16/h3,5,7-9,11-12,16-17H,2,4,6,10,19H2,1H3 |
| InChIKey | KWMPUDWOYDEZOU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |