C17H26N2 — CID 105007390
5,6,7,8-tetrahydroquinolin-8-yl-(2,2,3,3-tetramethylcyclopropyl)methanamine (PubChem CID 105007390) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-8-yl-(2,2,3,3-tetramethylcyclopropyl)methanamine.
| Compound Name | 5,6,7,8-tetrahydroquinolin-8-yl-(2,2,3,3-tetramethylcyclopropyl)methanamine |
|---|---|
| PubChem CID | 105007390 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-8-yl-(2,2,3,3-tetramethylcyclopropyl)methanamine |
| SMILES | CC1(C)C(C(N)C2CCCc3cccnc32)C1(C)C |
| InChI | InChI=1S/C17H26N2/c1-16(2)15(17(16,3)4)13(18)12-9-5-7-11-8-6-10-19-14(11)12/h6,8,10,12-13,15H,5,7,9,18H2,1-4H3 |
| InChIKey | ZWRMOEUNHSKXOM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |