C14H20N2S2 — CID 79972508
1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine (PubChem CID 79972508) has the molecular formula C14H20N2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine.
| Compound Name | 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
|---|---|
| PubChem CID | 79972508 |
| Molecular Formula | C14H20N2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanamine |
| SMILES | NC(C1CSCCS1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H20N2S2/c15-13(12-9-17-7-8-18-12)11-5-1-3-10-4-2-6-16-14(10)11/h2,4,6,11-13H,1,3,5,7-9,15H2 |
| InChIKey | JBTMMKBDHBMJKE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |