C14H19NOS2 — CID 79972633
1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanol (PubChem CID 79972633) has the molecular formula C14H19NOS2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanol.
| Compound Name | 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
|---|---|
| PubChem CID | 79972633 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1,4-dithian-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanol |
| SMILES | OC(C1CSCCS1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H19NOS2/c16-14(12-9-17-7-8-18-12)11-5-1-3-10-4-2-6-15-13(10)11/h2,4,6,11-12,14,16H,1,3,5,7-9H2 |
| InChIKey | CUOBQMFLKUNCDM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |