C14H20N2S — CID 105164783
5,6,7,8-tetrahydroquinolin-8-yl(thiolan-3-yl)methanamine (PubChem CID 105164783) has the molecular formula C14H20N2S and a molecular weight of 248.39 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-8-yl(thiolan-3-yl)methanamine.
| Compound Name | 5,6,7,8-tetrahydroquinolin-8-yl(thiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 105164783 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-8-yl(thiolan-3-yl)methanamine |
| SMILES | NC(C1CCSC1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H20N2S/c15-13(11-6-8-17-9-11)12-5-1-3-10-4-2-7-16-14(10)12/h2,4,7,11-13H,1,3,5-6,8-9,15H2 |
| InChIKey | QQZULDRVYQKSIO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |