C14H21N3 — CID 105224521
[cyclobutyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine (PubChem CID 105224521) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is [cyclobutyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine.
| Compound Name | [cyclobutyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105224521 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | [cyclobutyl(5,6,7,8-tetrahydroquinolin-8-yl)methyl]hydrazine |
| SMILES | NNC(C1CCC1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H21N3/c15-17-14(11-4-1-5-11)12-8-2-6-10-7-3-9-16-13(10)12/h3,7,9,11-12,14,17H,1-2,4-6,8,15H2 |
| InChIKey | KRKPDIGYJYCUGZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|