C17H21N3S — CID 105322035
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]hydrazine (PubChem CID 105322035) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322035 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCc2sccc21)C1CCc2cccnc21 |
| InChI | InChI=1S/C17H21N3S/c18-20-17(13-4-1-5-15-12(13)8-10-21-15)14-7-6-11-3-2-9-19-16(11)14/h2-3,8-10,13-14,17,20H,1,4-7,18H2 |
| InChIKey | UEBCEAVMKOMOSK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|