C15H23N3 — CID 105322002
[6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(1-methylcyclopentyl)methyl]hydrazine (PubChem CID 105322002) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(1-methylcyclopentyl)methyl]hydrazine.
| Compound Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(1-methylcyclopentyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105322002 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | [6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl-(1-methylcyclopentyl)methyl]hydrazine |
| SMILES | CC1(C(NN)C2CCc3cccnc32)CCCC1 |
| InChI | InChI=1S/C15H23N3/c1-15(8-2-3-9-15)14(18-16)12-7-6-11-5-4-10-17-13(11)12/h4-5,10,12,14,18H,2-3,6-9,16H2,1H3 |
| InChIKey | UGVOTSDOHVNBNI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|