C17H27N3 — CID 105255149
[cyclooctyl(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine (PubChem CID 105255149) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is [cyclooctyl(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine.
| Compound Name | [cyclooctyl(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105255149 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | [cyclooctyl(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCCCCC1)C1CCc2cccnc21 |
| InChI | InChI=1S/C17H27N3/c18-20-17(13-7-4-2-1-3-5-8-13)15-11-10-14-9-6-12-19-16(14)15/h6,9,12-13,15,17,20H,1-5,7-8,10-11,18H2 |
| InChIKey | MIEWSKRYYRVJTO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|