C10H13F2N3 — CID 105265157
[1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265157) has the molecular formula C10H13F2N3 and a molecular weight of 213.23 g/mol. Its IUPAC name is [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265157 |
| Molecular Formula | C10H13F2N3 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(C(F)F)C1CCc2cccnc21 |
| InChI | InChI=1S/C10H13F2N3/c11-10(12)9(15-13)7-4-3-6-2-1-5-14-8(6)7/h1-2,5,7,9-10,15H,3-4,13H2 |
| InChIKey | QEBMISTXDOVQPA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|