C16H18FN3 — CID 105198346
[1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(4-fluorophenyl)ethyl]hydrazine (PubChem CID 105198346) has the molecular formula C16H18FN3 and a molecular weight of 271.34 g/mol. Its IUPAC name is [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(4-fluorophenyl)ethyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105198346 |
| Molecular Formula | C16H18FN3 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-2-(4-fluorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(F)cc1)C1CCc2cccnc21 |
| InChI | InChI=1S/C16H18FN3/c17-13-6-3-11(4-7-13)10-15(20-18)14-8-5-12-2-1-9-19-16(12)14/h1-4,6-7,9,14-15,20H,5,8,10,18H2 |
| InChIKey | JORFUGFGDKGPNA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|