C16H21N3S — CID 105322071
[1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-thiophen-2-ylbutyl]hydrazine (PubChem CID 105322071) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-thiophen-2-ylbutyl]hydrazine.
| Compound Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-thiophen-2-ylbutyl]hydrazine |
|---|---|
| PubChem CID | 105322071 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | [1-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)-4-thiophen-2-ylbutyl]hydrazine |
| SMILES | NNC(CCCc1cccs1)C1CCc2cccnc21 |
| InChI | InChI=1S/C16H21N3S/c17-19-15(7-1-5-13-6-3-11-20-13)14-9-8-12-4-2-10-18-16(12)14/h2-4,6,10-11,14-15,19H,1,5,7-9,17H2 |
| InChIKey | KBWRKFLWMYXXEZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|