C17H19NOS — CID 105114181
1-(5,6,7,8-tetrahydroquinolin-8-yl)-4-thiophen-2-ylbutan-1-one (PubChem CID 105114181) has the molecular formula C17H19NOS and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydroquinolin-8-yl)-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 105114181 |
| Molecular Formula | C17H19NOS |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1-(5,6,7,8-tetrahydroquinolin-8-yl)-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C17H19NOS/c19-16(10-2-7-14-8-4-12-20-14)15-9-1-5-13-6-3-11-18-17(13)15/h3-4,6,8,11-12,15H,1-2,5,7,9-10H2 |
| InChIKey | NYZUJOQCTQRBEF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |