C14H20N2O — CID 116555632
4-(methylamino)-1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-one (PubChem CID 116555632) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 4-(methylamino)-1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-one.
| Compound Name | 4-(methylamino)-1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-one |
|---|---|
| PubChem CID | 116555632 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 4-(methylamino)-1-(5,6,7,8-tetrahydroquinolin-8-yl)butan-1-one |
| SMILES | CNCCCC(=O)C1CCCc2cccnc21 |
| InChI | InChI=1S/C14H20N2O/c1-15-9-4-8-13(17)12-7-2-5-11-6-3-10-16-14(11)12/h3,6,10,12,15H,2,4-5,7-9H2,1H3 |
| InChIKey | JUCIPQFFNWYYJV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|