C18H20N2O — CID 116603381
3-(3-aminophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one (PubChem CID 116603381) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-(3-aminophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one.
| Compound Name | 3-(3-aminophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one |
|---|---|
| PubChem CID | 116603381 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(3-aminophenyl)-1-(5,6,7,8-tetrahydroquinolin-8-yl)propan-1-one |
| SMILES | Nc1cccc(CCC(=O)C2CCCc3cccnc32)c1 |
| InChI | InChI=1S/C18H20N2O/c19-15-7-1-4-13(12-15)9-10-17(21)16-8-2-5-14-6-3-11-20-18(14)16/h1,3-4,6-7,11-12,16H,2,5,8-10,19H2 |
| InChIKey | FVTMCWFRDAMZPX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|