C18H15NO2 — CID 79732531
1-benzofuran-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanone (PubChem CID 79732531) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-benzofuran-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanone.
| Compound Name | 1-benzofuran-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
|---|---|
| PubChem CID | 79732531 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-benzofuran-2-yl(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
| SMILES | O=C(c1cc2ccccc2o1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C18H15NO2/c20-18(16-11-13-5-1-2-9-15(13)21-16)14-8-3-6-12-7-4-10-19-17(12)14/h1-2,4-5,7,9-11,14H,3,6,8H2 |
| InChIKey | ZLJZADDFVQHUJP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |