C16H15ClN2O — CID 79745583
(2-amino-4-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone (PubChem CID 79745583) has the molecular formula C16H15ClN2O and a molecular weight of 286.76 g/mol. Its IUPAC name is (2-amino-4-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone.
| Compound Name | (2-amino-4-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
|---|---|
| PubChem CID | 79745583 |
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | (2-amino-4-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
| SMILES | Nc1cc(Cl)ccc1C(=O)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H15ClN2O/c17-11-6-7-12(14(18)9-11)16(20)13-5-1-3-10-4-2-8-19-15(10)13/h2,4,6-9,13H,1,3,5,18H2 |
| InChIKey | RZOBVGMTCDWTTO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|