C16H15FN2O — CID 116547254
(4-amino-3-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone (PubChem CID 116547254) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is (4-amino-3-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone.
| Compound Name | (4-amino-3-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
|---|---|
| PubChem CID | 116547254 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (4-amino-3-fluorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
| SMILES | Nc1ccc(C(=O)C2CCCc3cccnc32)cc1F |
| InChI | InChI=1S/C16H15FN2O/c17-13-9-11(6-7-14(13)18)16(20)12-5-1-3-10-4-2-8-19-15(10)12/h2,4,6-9,12H,1,3,5,18H2 |
| InChIKey | ZIVMYZBXNRGGQS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|