C16H14ClNO — CID 79746265
(2-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone (PubChem CID 79746265) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is (2-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone.
| Compound Name | (2-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
|---|---|
| PubChem CID | 79746265 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (2-chlorophenyl)-(5,6,7,8-tetrahydroquinolin-8-yl)methanone |
| SMILES | O=C(c1ccccc1Cl)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H14ClNO/c17-14-9-2-1-7-12(14)16(19)13-8-3-5-11-6-4-10-18-15(11)13/h1-2,4,6-7,9-10,13H,3,5,8H2 |
| InChIKey | DJRHNKJUAORWRA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |