C16H12F3NO — CID 79732335
5,6,7,8-tetrahydroquinolin-8-yl-(3,4,5-trifluorophenyl)methanone (PubChem CID 79732335) has the molecular formula C16H12F3NO and a molecular weight of 291.27 g/mol. Its IUPAC name is 5,6,7,8-tetrahydroquinolin-8-yl-(3,4,5-trifluorophenyl)methanone.
| Compound Name | 5,6,7,8-tetrahydroquinolin-8-yl-(3,4,5-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 79732335 |
| Molecular Formula | C16H12F3NO |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 5,6,7,8-tetrahydroquinolin-8-yl-(3,4,5-trifluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C16H12F3NO/c17-12-7-10(8-13(18)14(12)19)16(21)11-5-1-3-9-4-2-6-20-15(9)11/h2,4,6-8,11H,1,3,5H2 |
| InChIKey | GYYYWASQZHVTTJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|